About 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane
2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane (PubChem CID 142407965) has the molecular formula C19H43F2N3O2
and a molecular weight of 383.57 g/mol. Its IUPAC name is 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane.
Molecular Properties
| Compound Name | 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane |
| PubChem CID | 142407965 |
| Molecular Formula | C19H43F2N3O2 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane |
| SMILES | CC.CC.CNCC(F)(F)COCCCCN1CCN(CCOC)CC1 |
| InChI | InChI=1S/C15H31F2N3O2.2C2H6/c1-18-13-15(16,17)14-22-11-4-3-5-19-6-8-20(9-7-19)10-12-21-2;2*1-2/h18H,3-14H2,1-2H3;2*1-2H3 |
| InChIKey | LDVGSWFZZPWYJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane?
The IUPAC name of 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane (CID 142407965) is 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane.
What is the SMILES notation for 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane?
The canonical SMILES for 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane is CC.CC.CNCC(F)(F)COCCCCN1CCN(CCOC)CC1.
What is the InChIKey of 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane?
The InChIKey is LDVGSWFZZPWYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31F2N3O2.2C2H6/c1-18-13-15(16,17)14-22-11-4-3-5-19-6-8-20(9-7-19)10-12-21-2;2*1-2/h18H,3-14H2,1-2H3;2*1-2H3.
What are the key properties of 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane?
2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane has a molecular weight of 383.57 g/mol, XLogP of 2.95, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]-N-methylpropan-1-amine;ethane is sourced from PubChem (CID 142407965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).