C20H21NO4 — CID 14240822
14,16-dimethoxy-8,10-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-5,15-diol (PubChem CID 14240822) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 14,16-dimethoxy-8,10-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-5,15-diol.
| Compound Name | 14,16-dimethoxy-8,10-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-5,15-diol |
|---|---|
| PubChem CID | 14240822 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 14,16-dimethoxy-8,10-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-5,15-diol |
| SMILES | COc1c(O)c(OC)c2c3c1CCN(C)c3c(C)c1cc(O)ccc12 |
| InChI | InChI=1S/C20H21NO4/c1-10-14-9-11(22)5-6-12(14)16-15-13(7-8-21(2)17(10)15)19(24-3)18(23)20(16)25-4/h5-6,9,22-23H,7-8H2,1-4H3 |
| InChIKey | PGQAEFMZGSICRI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|