C34H46N4O3 — CID 142408226
3-[3-amino-4-[ethyl(methylamino)amino]-2-methylphenyl]-3-[2-(2,3,5-trimethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid;ethane (PubChem CID 142408226) has the molecular formula C34H46N4O3 and a molecular weight of 558.77 g/mol. Its IUPAC name is 3-[3-amino-4-[ethyl(methylamino)amino]-2-methylphenyl]-3-[2-(2,3,5-trimethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid;ethane.
| Compound Name | 3-[3-amino-4-[ethyl(methylamino)amino]-2-methylphenyl]-3-[2-(2,3,5-trimethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid;ethane |
|---|---|
| PubChem CID | 142408226 |
| Molecular Formula | C34H46N4O3 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 3-[3-amino-4-[ethyl(methylamino)amino]-2-methylphenyl]-3-[2-(2,3,5-trimethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid;ethane |
| SMILES | CC.CCN(NC)c1ccc(C(CC(=O)O)c2ccc3c(c2)CN(C(=O)c2cc(C)cc(C)c2C)CC3)c(C)c1N |
| InChI | InChI=1S/C32H40N4O3.C2H6/c1-7-36(34-6)29-11-10-26(22(5)31(29)33)28(17-30(37)38)24-9-8-23-12-13-35(18-25(23)16-24)32(39)27-15-19(2)14-20(3)21(27)4;1-2/h8-11,14-16,28,34H,7,12-13,17-18,33H2,1-6H3,(H,37,38);1-2H3 |
| InChIKey | WIMCNQFFZZLWMN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|