C20H36O2 — CID 14240884
(2R,3S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyloct-6-ene-1,3-diol (PubChem CID 14240884) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2R,3S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyloct-6-ene-1,3-diol.
| Compound Name | (2R,3S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyloct-6-ene-1,3-diol |
|---|---|
| PubChem CID | 14240884 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (2R,3S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyloct-6-ene-1,3-diol |
| SMILES | CC(C)=CCC/C(C)=C/C[C@H](CO)[C@@](C)(O)CCC=C(C)C |
| InChI | InChI=1S/C20H36O2/c1-16(2)9-7-11-18(5)12-13-19(15-21)20(6,22)14-8-10-17(3)4/h9-10,12,19,21-22H,7-8,11,13-15H2,1-6H3/b18-12+/t19-,20+/m1/s1 |
| InChIKey | OAKVKJQFXGOQPH-FRKBIFFFSA-N |
| XLogP | 5.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|