About pentyl oxane-3-carboxylate
pentyl oxane-3-carboxylate (PubChem CID 142409111) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is pentyl oxane-3-carboxylate.
Molecular Properties
| Compound Name | pentyl oxane-3-carboxylate |
| PubChem CID | 142409111 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | pentyl oxane-3-carboxylate |
| SMILES | CCCCCOC(=O)C1CCCOC1 |
| InChI | InChI=1S/C11H20O3/c1-2-3-4-8-14-11(12)10-6-5-7-13-9-10/h10H,2-9H2,1H3 |
| InChIKey | BYMMDSBZUIIYNU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl oxane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl oxane-3-carboxylate?
The IUPAC name of pentyl oxane-3-carboxylate (CID 142409111) is pentyl oxane-3-carboxylate.
What is the SMILES notation for pentyl oxane-3-carboxylate?
The canonical SMILES for pentyl oxane-3-carboxylate is CCCCCOC(=O)C1CCCOC1.
What is the InChIKey of pentyl oxane-3-carboxylate?
The InChIKey is BYMMDSBZUIIYNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-3-4-8-14-11(12)10-6-5-7-13-9-10/h10H,2-9H2,1H3.
What are the key properties of pentyl oxane-3-carboxylate?
pentyl oxane-3-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl oxane-3-carboxylate is sourced from PubChem (CID 142409111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).