About ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine
ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine (PubChem CID 142409173) has the molecular formula C14H31NS
and a molecular weight of 245.48 g/mol. Its IUPAC name is ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine.
Molecular Properties
| Compound Name | ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine |
| PubChem CID | 142409173 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine |
| SMILES | C=S(=C)(C)CCN(C)C1CCCCC1.CC |
| InChI | InChI=1S/C12H25NS.C2H6/c1-13(10-11-14(2,3)4)12-8-6-5-7-9-12;1-2/h12H,2-3,5-11H2,1,4H3;1-2H3 |
| InChIKey | LBSFDWAIVMQLOG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine?
The IUPAC name of ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine (CID 142409173) is ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine.
What is the SMILES notation for ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine?
The canonical SMILES for ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine is C=S(=C)(C)CCN(C)C1CCCCC1.CC.
What is the InChIKey of ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine?
The InChIKey is LBSFDWAIVMQLOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NS.C2H6/c1-13(10-11-14(2,3)4)12-8-6-5-7-9-12;1-2/h12H,2-3,5-11H2,1,4H3;1-2H3.
What are the key properties of ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine?
ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine has a molecular weight of 245.48 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-N-[2-[methyl(dimethylidene)-λ6-sulfanyl]ethyl]cyclohexanamine is sourced from PubChem (CID 142409173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).