About ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane
ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane (PubChem CID 142409418) has the molecular formula C17H40N2O
and a molecular weight of 288.52 g/mol. Its IUPAC name is ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane.
Molecular Properties
| Compound Name | ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane |
| PubChem CID | 142409418 |
| Molecular Formula | C17H40N2O |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.31 |
| IUPAC Name | ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane |
| SMILES | CC.CCC(C)OC(C)(C)C.CCN1CCNCC1C |
| InChI | InChI=1S/C8H18O.C7H16N2.C2H6/c1-6-7(2)9-8(3,4)5;1-3-9-5-4-8-6-7(9)2;1-2/h7H,6H2,1-5H3;7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | NOCNRGWKTJEMML-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane?
The IUPAC name of ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane (CID 142409418) is ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane.
What is the SMILES notation for ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane?
The canonical SMILES for ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane is CC.CCC(C)OC(C)(C)C.CCN1CCNCC1C.
What is the InChIKey of ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane?
The InChIKey is NOCNRGWKTJEMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C7H16N2.C2H6/c1-6-7(2)9-8(3,4)5;1-3-9-5-4-8-6-7(9)2;1-2/h7H,6H2,1-5H3;7-8H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane?
ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane has a molecular weight of 288.52 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2-methylpiperazine;2-[(2-methylpropan-2-yl)oxy]butane is sourced from PubChem (CID 142409418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).