C16H35N — CID 142409504
ethane;1-methyl-4-(2,2,4-trimethylpentyl)piperidine (PubChem CID 142409504) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is ethane;1-methyl-4-(2,2,4-trimethylpentyl)piperidine.
| Compound Name | ethane;1-methyl-4-(2,2,4-trimethylpentyl)piperidine |
|---|---|
| PubChem CID | 142409504 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | ethane;1-methyl-4-(2,2,4-trimethylpentyl)piperidine |
| SMILES | CC.CC(C)CC(C)(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C14H29N.C2H6/c1-12(2)10-14(3,4)11-13-6-8-15(5)9-7-13;1-2/h12-13H,6-11H2,1-5H3;1-2H3 |
| InChIKey | QOIZYHXJBDWRBN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |