C17H21N3O3S — CID 142410305
2-[(2E)-2-[(E)-[4-(2,2-dimethylpropyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 142410305) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-[4-(2,2-dimethylpropyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(E)-[4-(2,2-dimethylpropyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 142410305 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(2E)-2-[(E)-[4-(2,2-dimethylpropyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CC(C)(C)Cc1ccc(/C=N/N=C2\NC(=O)C(CC(=O)O)S2)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-17(2,3)9-11-4-6-12(7-5-11)10-18-20-16-19-15(23)13(24-16)8-14(21)22/h4-7,10,13H,8-9H2,1-3H3,(H,21,22)(H,19,20,23)/b18-10+ |
| InChIKey | SKPFHDUDAIUPSH-VCHYOVAHSA-N |
| XLogP | 2.67 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|