About N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane
N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane (PubChem CID 142410317) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane.
Molecular Properties
| Compound Name | N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane |
| PubChem CID | 142410317 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane |
| SMILES | C=C/C(=C\N=C)C(C)(C)C.CC |
| InChI | InChI=1S/C9H15N.C2H6/c1-6-8(7-10-5)9(2,3)4;1-2/h6-7H,1,5H2,2-4H3;1-2H3/b8-7+; |
| InChIKey | YEJFIEJEKQBFKI-USRGLUTNSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane?
The IUPAC name of N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane (CID 142410317) is N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane.
What is the SMILES notation for N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane?
The canonical SMILES for N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane is C=C/C(=C\N=C)C(C)(C)C.CC.
What is the InChIKey of N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane?
The InChIKey is YEJFIEJEKQBFKI-USRGLUTNSA-N. The full InChI is InChI=1S/C9H15N.C2H6/c1-6-8(7-10-5)9(2,3)4;1-2/h6-7H,1,5H2,2-4H3;1-2H3/b8-7+;.
What are the key properties of N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane?
N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane has a molecular weight of 167.30 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-2-tert-butylbuta-1,3-dienyl]methanimine;ethane is sourced from PubChem (CID 142410317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).