C19H27N3O3S — CID 142410339
2,4-dimethyl-1-(2-methylbutan-2-yl)benzene;2-[(2E)-2-(methylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 142410339) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2,4-dimethyl-1-(2-methylbutan-2-yl)benzene;2-[(2E)-2-(methylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2,4-dimethyl-1-(2-methylbutan-2-yl)benzene;2-[(2E)-2-(methylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 142410339 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2,4-dimethyl-1-(2-methylbutan-2-yl)benzene;2-[(2E)-2-(methylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | C=N/N=C1\NC(=O)C(CC(=O)O)S1.CCC(C)(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H20.C6H7N3O3S/c1-6-13(4,5)12-8-7-10(2)9-11(12)3;1-7-9-6-8-5(12)3(13-6)2-4(10)11/h7-9H,6H2,1-5H3;3H,1-2H2,(H,10,11)(H,8,9,12) |
| InChIKey | BDGDHXWSJDWBPW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|