C24H31ClF2N4OSi — CID 142410427
2-[[4-chloro-6-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142410427) has the molecular formula C24H31ClF2N4OSi and a molecular weight of 493.07 g/mol. Its IUPAC name is 2-[[4-chloro-6-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-chloro-6-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142410427 |
| Molecular Formula | C24H31ClF2N4OSi |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[[4-chloro-6-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(CN3CCC(F)(F)CC3)cc2)cc2c(Cl)ncnc21 |
| InChI | InChI=1S/C24H31ClF2N4OSi/c1-33(2,3)13-12-32-17-31-21(14-20-22(25)28-16-29-23(20)31)19-6-4-18(5-7-19)15-30-10-8-24(26,27)9-11-30/h4-7,14,16H,8-13,15,17H2,1-3H3 |
| InChIKey | YSMNZODWXGMHOF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|