C28H29N5O2 — CID 142410466
N-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 142410466) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142410466 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2c(C)cnc3[nH]c(-c4ccc(N5CCN(C)CC5)cc4)cc23)c1 |
| InChI | InChI=1S/C28H29N5O2/c1-4-26(34)30-21-6-5-7-23(16-21)35-27-19(2)18-29-28-24(27)17-25(31-28)20-8-10-22(11-9-20)33-14-12-32(3)13-15-33/h4-11,16-18H,1,12-15H2,2-3H3,(H,29,31)(H,30,34) |
| InChIKey | LIYMGDQXMSCGEY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|