C28H30ClN5O6 — CID 142410664
4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide (PubChem CID 142410664) has the molecular formula C28H30ClN5O6 and a molecular weight of 568.03 g/mol. Its IUPAC name is 4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide.
| Compound Name | 4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 142410664 |
| Molecular Formula | C28H30ClN5O6 |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(Oc3ccc(NC(=O)Nc4cc(C(C)(C)C)on4)c(Cl)c3)ccnc2cc1OC |
| InChI | InChI=1S/C28H30ClN5O6/c1-28(2,3)24-15-25(34-40-24)33-27(36)32-20-7-6-16(12-19(20)29)39-22-8-9-30-21-14-23(38-5)18(13-17(21)22)26(35)31-10-11-37-4/h6-9,12-15H,10-11H2,1-5H3,(H,31,35)(H2,32,33,34,36) |
| InChIKey | HGERRYXDEQCIGO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|