About 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone
2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 142410788) has the molecular formula C17H13BrF3NO4
and a molecular weight of 432.19 g/mol. Its IUPAC name is 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone |
| PubChem CID | 142410788 |
| Molecular Formula | C17H13BrF3NO4 |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | O=C(CBr)c1ccc(Oc2ccc(C3OCCO3)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C17H13BrF3NO4/c18-9-13(23)12-5-6-14(22-15(12)17(19,20)21)26-11-3-1-10(2-4-11)16-24-7-8-25-16/h1-6,16H,7-9H2 |
| InChIKey | FXANVNWELIGNNK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone?
The IUPAC name of 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone (CID 142410788) is 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone.
What is the SMILES notation for 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone?
The canonical SMILES for 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone is O=C(CBr)c1ccc(Oc2ccc(C3OCCO3)cc2)nc1C(F)(F)F.
What is the InChIKey of 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone?
The InChIKey is FXANVNWELIGNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrF3NO4/c18-9-13(23)12-5-6-14(22-15(12)17(19,20)21)26-11-3-1-10(2-4-11)16-24-7-8-25-16/h1-6,16H,7-9H2.
What are the key properties of 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone?
2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone has a molecular weight of 432.19 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone is sourced from PubChem (CID 142410788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).