C17H13BrF3NO4 — CID 142410788
2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 142410788) has the molecular formula C17H13BrF3NO4 and a molecular weight of 432.19 g/mol. Its IUPAC name is 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone.
| Compound Name | 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 142410788 |
| Molecular Formula | C17H13BrF3NO4 |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 2-bromo-1-[6-[4-(1,3-dioxolan-2-yl)phenoxy]-2-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | O=C(CBr)c1ccc(Oc2ccc(C3OCCO3)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C17H13BrF3NO4/c18-9-13(23)12-5-6-14(22-15(12)17(19,20)21)26-11-3-1-10(2-4-11)16-24-7-8-25-16/h1-6,16H,7-9H2 |
| InChIKey | FXANVNWELIGNNK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|