About 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde
4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde (PubChem CID 142410805) has the molecular formula C17H11F3N4O3
and a molecular weight of 376.29 g/mol. Its IUPAC name is 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde.
Molecular Properties
| Compound Name | 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde |
| PubChem CID | 142410805 |
| Molecular Formula | C17H11F3N4O3 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde |
| SMILES | O=Cc1ccc(Oc2ccc(C(=O)Cn3cncn3)c(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H11F3N4O3/c18-17(19,20)16-13(14(26)7-24-10-21-9-22-24)5-6-15(23-16)27-12-3-1-11(8-25)2-4-12/h1-6,8-10H,7H2 |
| InChIKey | FSODXJQQPDGPIV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde?
The IUPAC name of 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde (CID 142410805) is 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde.
What is the SMILES notation for 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde?
The canonical SMILES for 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde is O=Cc1ccc(Oc2ccc(C(=O)Cn3cncn3)c(C(F)(F)F)n2)cc1.
What is the InChIKey of 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde?
The InChIKey is FSODXJQQPDGPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3N4O3/c18-17(19,20)16-13(14(26)7-24-10-21-9-22-24)5-6-15(23-16)27-12-3-1-11(8-25)2-4-12/h1-6,8-10H,7H2.
What are the key properties of 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde?
4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde has a molecular weight of 376.29 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[2-(1,2,4-triazol-1-yl)acetyl]-6-(trifluoromethyl)-2-pyridinyl]oxy]benzaldehyde is sourced from PubChem (CID 142410805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).