C20H22ClN5O3 — CID 142411209
6-(4-chlorophenyl)-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxamide;oxane (PubChem CID 142411209) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxamide;oxane.
| Compound Name | 6-(4-chlorophenyl)-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxamide;oxane |
|---|---|
| PubChem CID | 142411209 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxamide;oxane |
| SMILES | C1CCOCC1.Cn1cc(-n2nc(-c3ccc(Cl)cc3)cc(C(N)=O)c2=O)cn1 |
| InChI | InChI=1S/C15H12ClN5O2.C5H10O/c1-20-8-11(7-18-20)21-15(23)12(14(17)22)6-13(19-21)9-2-4-10(16)5-3-9;1-2-4-6-5-3-1/h2-8H,1H3,(H2,17,22);1-5H2 |
| InChIKey | HXJVWKRGVIPACU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |