About 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid
3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid (PubChem CID 142412709) has the molecular formula C16H11F3N2O5
and a molecular weight of 368.27 g/mol. Its IUPAC name is 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid |
| PubChem CID | 142412709 |
| Molecular Formula | C16H11F3N2O5 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid |
| SMILES | O=C(O)CCn1c(=O)oc2ccc(-c3ccc(OC(F)(F)F)cc3)nc21 |
| InChI | InChI=1S/C16H11F3N2O5/c17-16(18,19)26-10-3-1-9(2-4-10)11-5-6-12-14(20-11)21(15(24)25-12)8-7-13(22)23/h1-6H,7-8H2,(H,22,23) |
| InChIKey | OILBMVFYGXWDMK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid?
The IUPAC name of 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid (CID 142412709) is 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid.
What is the SMILES notation for 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid?
The canonical SMILES for 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid is O=C(O)CCn1c(=O)oc2ccc(-c3ccc(OC(F)(F)F)cc3)nc21.
What is the InChIKey of 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid?
The InChIKey is OILBMVFYGXWDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2O5/c17-16(18,19)26-10-3-1-9(2-4-10)11-5-6-12-14(20-11)21(15(24)25-12)8-7-13(22)23/h1-6H,7-8H2,(H,22,23).
What are the key properties of 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid?
3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid has a molecular weight of 368.27 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]propanoic acid is sourced from PubChem (CID 142412709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).