C16H11NO4S — CID 142413177
6-(benzenesulfonyl)furo[2,3-e]indol-3-one (PubChem CID 142413177) has the molecular formula C16H11NO4S and a molecular weight of 313.33 g/mol. Its IUPAC name is 6-(benzenesulfonyl)furo[2,3-e]indol-3-one.
| Compound Name | 6-(benzenesulfonyl)furo[2,3-e]indol-3-one |
|---|---|
| PubChem CID | 142413177 |
| Molecular Formula | C16H11NO4S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 6-(benzenesulfonyl)furo[2,3-e]indol-3-one |
| SMILES | O=C1COc2c1ccc1c2ccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H11NO4S/c18-15-10-21-16-12-8-9-17(14(12)7-6-13(15)16)22(19,20)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | DXAYALAYXJRAPA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |