About (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine
(2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine (PubChem CID 142413614) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine |
| PubChem CID | 142413614 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)NC(=C)C1(C(=C)C)CC1 |
| InChI | InChI=1S/C13H19N/c1-6-7-11(4)14-12(5)13(8-9-13)10(2)3/h6-7,14H,1-2,5,8-9H2,3-4H3/b11-7+ |
| InChIKey | UELSSRGRPUXXOF-YRNVUSSQSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine?
The IUPAC name of (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine (CID 142413614) is (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine?
The canonical SMILES for (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine is C=C/C=C(\C)NC(=C)C1(C(=C)C)CC1.
What is the InChIKey of (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine?
The InChIKey is UELSSRGRPUXXOF-YRNVUSSQSA-N. The full InChI is InChI=1S/C13H19N/c1-6-7-11(4)14-12(5)13(8-9-13)10(2)3/h6-7,14H,1-2,5,8-9H2,3-4H3/b11-7+.
What are the key properties of (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine?
(2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine has a molecular weight of 189.30 g/mol, XLogP of 3.54, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-[1-(1-prop-1-en-2-ylcyclopropyl)ethenyl]penta-2,4-dien-2-amine is sourced from PubChem (CID 142413614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).