C16H15N3O3 — CID 142413626
1-N-(4-hydroxyphenyl)-1-N'-pyridin-2-ylcyclopropane-1,1-dicarboxamide (PubChem CID 142413626) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-N-(4-hydroxyphenyl)-1-N'-pyridin-2-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-hydroxyphenyl)-1-N'-pyridin-2-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 142413626 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-N-(4-hydroxyphenyl)-1-N'-pyridin-2-ylcyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1(C(=O)Nc2ccccn2)CC1 |
| InChI | InChI=1S/C16H15N3O3/c20-12-6-4-11(5-7-12)18-14(21)16(8-9-16)15(22)19-13-3-1-2-10-17-13/h1-7,10,20H,8-9H2,(H,18,21)(H,17,19,22) |
| InChIKey | YSSFJXBNEZAVSV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|