About 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole
2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole (PubChem CID 142413744) has the molecular formula C17H18BrN3O
and a molecular weight of 360.26 g/mol. Its IUPAC name is 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole |
| PubChem CID | 142413744 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole |
| SMILES | CN1CCC(Oc2cccc3nc4ccc(Br)cn4c23)CC1 |
| InChI | InChI=1S/C17H18BrN3O/c1-20-9-7-13(8-10-20)22-15-4-2-3-14-17(15)21-11-12(18)5-6-16(21)19-14/h2-6,11,13H,7-10H2,1H3 |
| InChIKey | DDHJTJIKGXYFCN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole?
The IUPAC name of 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole (CID 142413744) is 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole.
What is the SMILES notation for 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole?
The canonical SMILES for 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole is CN1CCC(Oc2cccc3nc4ccc(Br)cn4c23)CC1.
What is the InChIKey of 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole?
The InChIKey is DDHJTJIKGXYFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrN3O/c1-20-9-7-13(8-10-20)22-15-4-2-3-14-17(15)21-11-12(18)5-6-16(21)19-14/h2-6,11,13H,7-10H2,1H3.
What are the key properties of 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole?
2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole has a molecular weight of 360.26 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9-(1-methylpiperidin-4-yl)oxypyrido[1,2-a]benzimidazole is sourced from PubChem (CID 142413744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).