C25H22ClN7O2 — CID 142413805
7-(2-chloro-3,5-dimethoxyphenyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 142413805) has the molecular formula C25H22ClN7O2 and a molecular weight of 487.95 g/mol. Its IUPAC name is 7-(2-chloro-3,5-dimethoxyphenyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 142413805 |
| Molecular Formula | C25H22ClN7O2 |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc5c(c4)CCNC5)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C25H22ClN7O2/c1-34-18-9-19(22(26)21(10-18)35-2)20-8-16-12-28-25(31-23(16)33-13-29-32-24(20)33)30-17-4-3-15-11-27-6-5-14(15)7-17/h3-4,7-10,12-13,27H,5-6,11H2,1-2H3,(H,28,30,31) |
| InChIKey | UJKFLFOBPZHDJN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |