C28H27ClN8O3 — CID 142413817
1-[4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 142413817) has the molecular formula C28H27ClN8O3 and a molecular weight of 559.03 g/mol. Its IUPAC name is 1-[4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142413817 |
| Molecular Formula | C28H27ClN8O3 |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 1-[4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(N5CCN(C(C)=O)CC5)cc4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C28H27ClN8O3/c1-17(38)35-8-10-36(11-9-35)20-6-4-19(5-7-20)32-28-30-15-18-12-23(27-34-31-16-37(27)26(18)33-28)22-13-21(39-2)14-24(40-3)25(22)29/h4-7,12-16H,8-11H2,1-3H3,(H,30,32,33) |
| InChIKey | QGVDUZPALGLYPE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|