C29H29ClN8O2 — CID 142413833
N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 142413833) has the molecular formula C29H29ClN8O2 and a molecular weight of 557.06 g/mol. Its IUPAC name is N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 142413833 |
| Molecular Formula | C29H29ClN8O2 |
| Molecular Weight | 557.06 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(N5CCN6CCC[C@H]6C5)cc4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C29H29ClN8O2/c1-39-22-13-23(26(30)25(14-22)40-2)24-12-18-15-31-29(34-27(18)38-17-32-35-28(24)38)33-19-5-7-20(8-6-19)37-11-10-36-9-3-4-21(36)16-37/h5-8,12-15,17,21H,3-4,9-11,16H2,1-2H3,(H,31,33,34)/t21-/m0/s1 |
| InChIKey | NRMCPJZXGKOTEB-NRFANRHFSA-N |
| XLogP | 5.04 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.06 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|