C31H33ClN8O2 — CID 142413843
7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 142413843) has the molecular formula C31H33ClN8O2 and a molecular weight of 585.11 g/mol. Its IUPAC name is 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 142413843 |
| Molecular Formula | C31H33ClN8O2 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(N5CCN(C6CCCC6)CC5)cc4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C31H33ClN8O2/c1-41-24-16-25(28(32)27(17-24)42-2)26-15-20-18-33-31(36-29(20)40-19-34-37-30(26)40)35-21-7-9-23(10-8-21)39-13-11-38(12-14-39)22-5-3-4-6-22/h7-10,15-19,22H,3-6,11-14H2,1-2H3,(H,33,35,36) |
| InChIKey | PPGIZZSZFJXZOK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|