C28H28ClN7O2 — CID 142413846
7-(2-chloro-3,5-dimethoxyphenyl)-N-(3-methyl-4-piperidin-4-ylphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 142413846) has the molecular formula C28H28ClN7O2 and a molecular weight of 530.03 g/mol. Its IUPAC name is 7-(2-chloro-3,5-dimethoxyphenyl)-N-(3-methyl-4-piperidin-4-ylphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-(3-methyl-4-piperidin-4-ylphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 142413846 |
| Molecular Formula | C28H28ClN7O2 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-(3-methyl-4-piperidin-4-ylphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(C5CCNCC5)c(C)c4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C28H28ClN7O2/c1-16-10-19(4-5-21(16)17-6-8-30-9-7-17)33-28-31-14-18-11-23(27-35-32-15-36(27)26(18)34-28)22-12-20(37-2)13-24(38-3)25(22)29/h4-5,10-15,17,30H,6-9H2,1-3H3,(H,31,33,34) |
| InChIKey | IOXFGZWOIUWPCI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |