C29H30ClN9O3 — CID 142413850
4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 142413850) has the molecular formula C29H30ClN9O3 and a molecular weight of 588.07 g/mol. Its IUPAC name is 4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 142413850 |
| Molecular Formula | C29H30ClN9O3 |
| Molecular Weight | 588.07 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 4-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(N5CCN(C(=O)N(C)C)CC5)cc4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C29H30ClN9O3/c1-36(2)29(40)38-11-9-37(10-12-38)20-7-5-19(6-8-20)33-28-31-16-18-13-23(27-35-32-17-39(27)26(18)34-28)22-14-21(41-3)15-24(42-4)25(22)30/h5-8,13-17H,9-12H2,1-4H3,(H,31,33,34) |
| InChIKey | FJFQQWACWLSMBR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.07 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|