C28H50Cl2N2O4 — CID 14241397
bis(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 14241397) has the molecular formula C28H50Cl2N2O4 and a molecular weight of 549.62 g/mol. Its IUPAC name is bis(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 14241397 |
| Molecular Formula | C28H50Cl2N2O4 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | bis(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(Cl)C(C)(C)C2)CC(C)(C)N1Cl |
| InChI | InChI=1S/C28H50Cl2N2O4/c1-25(2)17-21(18-26(3,4)31(25)29)35-23(33)15-13-11-9-10-12-14-16-24(34)36-22-19-27(5,6)32(30)28(7,8)20-22/h21-22H,9-20H2,1-8H3 |
| InChIKey | BWLOSIOFKQWJIU-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|