About 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide
6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide (PubChem CID 142414041) has the molecular formula C8H10IN3OS
and a molecular weight of 323.16 g/mol. Its IUPAC name is 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide.
Molecular Properties
| Compound Name | 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide |
| PubChem CID | 142414041 |
| Molecular Formula | C8H10IN3OS |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide |
| SMILES | [H]N=S1(=O)Cc2cnc(C(C)I)nc2C1 |
| InChI | InChI=1S/C8H10IN3OS/c1-5(9)8-11-2-6-3-14(10,13)4-7(6)12-8/h2,5,10H,3-4H2,1H3 |
| InChIKey | XZELRTQEVJUNRQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
The IUPAC name of 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide (CID 142414041) is 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide.
What is the SMILES notation for 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
The canonical SMILES for 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide is [H]N=S1(=O)Cc2cnc(C(C)I)nc2C1.
What is the InChIKey of 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
The InChIKey is XZELRTQEVJUNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10IN3OS/c1-5(9)8-11-2-6-3-14(10,13)4-7(6)12-8/h2,5,10H,3-4H2,1H3.
What are the key properties of 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide has a molecular weight of 323.16 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-2-(1-iodoethyl)-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide is sourced from PubChem (CID 142414041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).