C19H16F6N2O2 — CID 142414873
6-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 142414873) has the molecular formula C19H16F6N2O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 6-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 142414873 |
| Molecular Formula | C19H16F6N2O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 6-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2ccc(C3(C(F)(F)C(F)(F)F)CC3)cc2F)nc1 |
| InChI | InChI=1S/C19H16F6N2O2/c1-27(2)16(28)11-3-6-15(26-10-11)29-14-5-4-12(9-13(14)20)17(7-8-17)18(21,22)19(23,24)25/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | NGILPEIMAOBEIZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|