C17H11F6NO2 — CID 142414995
5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carbaldehyde (PubChem CID 142414995) has the molecular formula C17H11F6NO2 and a molecular weight of 375.27 g/mol. Its IUPAC name is 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carbaldehyde.
| Compound Name | 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 142414995 |
| Molecular Formula | C17H11F6NO2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carbaldehyde |
| SMILES | O=Cc1cnc(Oc2ccc(C3(C(F)(F)C(F)(F)F)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C17H11F6NO2/c18-13-7-10(9-25)8-24-14(13)26-12-3-1-11(2-4-12)15(5-6-15)16(19,20)17(21,22)23/h1-4,7-9H,5-6H2 |
| InChIKey | UVAYLGRHIIYPMO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|