About 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide
3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide (PubChem CID 142415050) has the molecular formula C19H17F4NO2
and a molecular weight of 367.34 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide.
Molecular Properties
| Compound Name | 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide |
| PubChem CID | 142415050 |
| Molecular Formula | C19H17F4NO2 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2ccc(C3(C(F)(F)F)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C19H17F4NO2/c1-24(2)17(25)12-3-8-16(15(20)11-12)26-14-6-4-13(5-7-14)18(9-10-18)19(21,22)23/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | IZYMIFXCVMFIQT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide?
The IUPAC name of 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide (CID 142415050) is 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide.
What is the SMILES notation for 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide?
The canonical SMILES for 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide is CN(C)C(=O)c1ccc(Oc2ccc(C3(C(F)(F)F)CC3)cc2)c(F)c1.
What is the InChIKey of 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide?
The InChIKey is IZYMIFXCVMFIQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F4NO2/c1-24(2)17(25)12-3-8-16(15(20)11-12)26-14-6-4-13(5-7-14)18(9-10-18)19(21,22)23/h3-8,11H,9-10H2,1-2H3.
What are the key properties of 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide?
3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide has a molecular weight of 367.34 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N-dimethyl-4-[4-[1-(trifluoromethyl)cyclopropyl]phenoxy]benzamide is sourced from PubChem (CID 142415050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).