C14H19N3 — CID 142415545
1,5-dimethyl-6-piperidin-3-ylpyrrolo[3,2-b]pyridine (PubChem CID 142415545) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1,5-dimethyl-6-piperidin-3-ylpyrrolo[3,2-b]pyridine.
| Compound Name | 1,5-dimethyl-6-piperidin-3-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 142415545 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1,5-dimethyl-6-piperidin-3-ylpyrrolo[3,2-b]pyridine |
| SMILES | Cc1nc2ccn(C)c2cc1C1CCCNC1 |
| InChI | InChI=1S/C14H19N3/c1-10-12(11-4-3-6-15-9-11)8-14-13(16-10)5-7-17(14)2/h5,7-8,11,15H,3-4,6,9H2,1-2H3 |
| InChIKey | QNYSQUYZIYBMTD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|