C19H23N5OS — CID 142415574
N-[5-[[3-(1-methylpyrrolo[3,2-b]pyridin-6-yl)piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 142415574) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[5-[[3-(1-methylpyrrolo[3,2-b]pyridin-6-yl)piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[3-(1-methylpyrrolo[3,2-b]pyridin-6-yl)piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 142415574 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[5-[[3-(1-methylpyrrolo[3,2-b]pyridin-6-yl)piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CCCC(c3cnc4ccn(C)c4c3)C2)s1 |
| InChI | InChI=1S/C19H23N5OS/c1-13(25)22-19-21-10-16(26-19)12-24-6-3-4-14(11-24)15-8-18-17(20-9-15)5-7-23(18)2/h5,7-10,14H,3-4,6,11-12H2,1-2H3,(H,21,22,25) |
| InChIKey | QDJOOFOWLZRAOG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|