About dibenzothiophene;9-phenylcarbazole
dibenzothiophene;9-phenylcarbazole (PubChem CID 142415981) has the molecular formula C30H21NS
and a molecular weight of 427.57 g/mol. Its IUPAC name is dibenzothiophene;9-phenylcarbazole.
Molecular Properties
| Compound Name | dibenzothiophene;9-phenylcarbazole |
| PubChem CID | 142415981 |
| Molecular Formula | C30H21NS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | dibenzothiophene;9-phenylcarbazole |
| SMILES | c1ccc(-n2c3ccccc3c3ccccc32)cc1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C18H13N.C12H8S/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-13H;1-8H |
| InChIKey | FJAGOJXXUFSXJX-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibenzothiophene;9-phenylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene;9-phenylcarbazole?
The IUPAC name of dibenzothiophene;9-phenylcarbazole (CID 142415981) is dibenzothiophene;9-phenylcarbazole.
What is the SMILES notation for dibenzothiophene;9-phenylcarbazole?
The canonical SMILES for dibenzothiophene;9-phenylcarbazole is c1ccc(-n2c3ccccc3c3ccccc32)cc1.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene;9-phenylcarbazole?
The InChIKey is FJAGOJXXUFSXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N.C12H8S/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-13H;1-8H.
What are the key properties of dibenzothiophene;9-phenylcarbazole?
dibenzothiophene;9-phenylcarbazole has a molecular weight of 427.57 g/mol, XLogP of 8.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene;9-phenylcarbazole is sourced from PubChem (CID 142415981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).