C21H38O2Si — CID 142416102
(4R,7S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-7-prop-1-en-2-ylspiro[4.5]decan-3-one (PubChem CID 142416102) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (4R,7S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-7-prop-1-en-2-ylspiro[4.5]decan-3-one.
| Compound Name | (4R,7S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-7-prop-1-en-2-ylspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 142416102 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (4R,7S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-7-prop-1-en-2-ylspiro[4.5]decan-3-one |
| SMILES | C=C(C)[C@H]1CC[C@H](CO[Si](C)(C)C(C)(C)C)C2(CCC(=O)[C@@H]2C)C1 |
| InChI | InChI=1S/C21H38O2Si/c1-15(2)17-9-10-18(14-23-24(7,8)20(4,5)6)21(13-17)12-11-19(22)16(21)3/h16-18H,1,9-14H2,2-8H3/t16-,17-,18+,21?/m0/s1 |
| InChIKey | ZRKWKKNSOUMLSP-NANJZHHASA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|