C20H36O3Si — CID 142416103
(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde (PubChem CID 142416103) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde.
| Compound Name | (1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 142416103 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde |
| SMILES | C=C(C)[C@H]1CC[C@H](CO[Si](C)(C)C(C)(C)C)[C@@](C=O)(CC(C)=O)C1 |
| InChI | InChI=1S/C20H36O3Si/c1-15(2)17-9-10-18(13-23-24(7,8)19(4,5)6)20(12-17,14-21)11-16(3)22/h14,17-18H,1,9-13H2,2-8H3/t17-,18+,20-/m0/s1 |
| InChIKey | KOSYXLRGZQPTQU-NSHGMRRFSA-N |
| XLogP | 5.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|