C34H46F2N4O2 — CID 142416775
tert-butyl (3R)-3-[[[(E)-4-[(4,4-difluorocyclohexyl)amino]but-2-enyl]-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 142416775) has the molecular formula C34H46F2N4O2 and a molecular weight of 580.76 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[[(E)-4-[(4,4-difluorocyclohexyl)amino]but-2-enyl]-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[[(E)-4-[(4,4-difluorocyclohexyl)amino]but-2-enyl]-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142416775 |
| Molecular Formula | C34H46F2N4O2 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | tert-butyl (3R)-3-[[[(E)-4-[(4,4-difluorocyclohexyl)amino]but-2-enyl]-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccccc2C[C@@H]1CN(C/C=C/CNC1CCC(F)(F)CC1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C34H46F2N4O2/c1-33(2,3)42-32(41)40-23-27-11-5-4-10-26(27)22-29(40)24-39(30-14-8-12-25-13-9-20-38-31(25)30)21-7-6-19-37-28-15-17-34(35,36)18-16-28/h4-7,9-11,13,20,28-30,37H,8,12,14-19,21-24H2,1-3H3/b7-6+/t29-,30+/m1/s1 |
| InChIKey | IEZWHRCHTYHZTQ-WXMANCQVSA-N |
| XLogP | 6.85 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|