C38H48F2N4O2 — CID 142416955
tert-butyl (3R)-3-[[[4-[[(4,4-difluorocyclohexyl)amino]methyl]phenyl]methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 142416955) has the molecular formula C38H48F2N4O2 and a molecular weight of 630.82 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[[4-[[(4,4-difluorocyclohexyl)amino]methyl]phenyl]methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[[4-[[(4,4-difluorocyclohexyl)amino]methyl]phenyl]methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142416955 |
| Molecular Formula | C38H48F2N4O2 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | tert-butyl (3R)-3-[[[4-[[(4,4-difluorocyclohexyl)amino]methyl]phenyl]methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccccc2C[C@@H]1CN(Cc1ccc(CNC2CCC(F)(F)CC2)cc1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C38H48F2N4O2/c1-37(2,3)46-36(45)44-25-31-9-5-4-8-30(31)22-33(44)26-43(34-12-6-10-29-11-7-21-41-35(29)34)24-28-15-13-27(14-16-28)23-42-32-17-19-38(39,40)20-18-32/h4-5,7-9,11,13-16,21,32-34,42H,6,10,12,17-20,22-26H2,1-3H3/t33-,34+/m1/s1 |
| InChIKey | DALLHJLAMLQHDU-NOCHOARKSA-N |
| XLogP | 7.99 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |