C47H78N4O8 — CID 142417601
2-O-[2-(ethylamino)-2-methylheptan-4-yl] 1-O,4-O,5-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate (PubChem CID 142417601) has the molecular formula C47H78N4O8 and a molecular weight of 827.16 g/mol. Its IUPAC name is 2-O-[2-(ethylamino)-2-methylheptan-4-yl] 1-O,4-O,5-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate.
| Compound Name | 2-O-[2-(ethylamino)-2-methylheptan-4-yl] 1-O,4-O,5-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 142417601 |
| Molecular Formula | C47H78N4O8 |
| Molecular Weight | 827.16 g/mol |
| Exact Mass | 826.58 |
| IUPAC Name | 2-O-[2-(ethylamino)-2-methylheptan-4-yl] 1-O,4-O,5-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate |
| SMILES | CCCC(CC(C)(C)NCC)OC(=O)c1cc(C(=O)OC2CC(C)(C)NC(C)(C)C2)c(C(=O)OC2CC(C)(C)NC(C)(C)C2)cc1C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C47H78N4O8/c1-17-19-29(22-41(3,4)48-18-2)56-37(52)33-20-35(39(54)58-31-25-44(9,10)50-45(11,12)26-31)36(40(55)59-32-27-46(13,14)51-47(15,16)28-32)21-34(33)38(53)57-30-23-42(5,6)49-43(7,8)24-30/h20-21,29-32,48-51H,17-19,22-28H2,1-16H3 |
| InChIKey | LJXPOJCRGZODKH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.16 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|