About 2,3-dihydronaphthalene;methane
2,3-dihydronaphthalene;methane (PubChem CID 142417654) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 2,3-dihydronaphthalene;methane.
Molecular Properties
| Compound Name | 2,3-dihydronaphthalene;methane |
| PubChem CID | 142417654 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2,3-dihydronaphthalene;methane |
| SMILES | C.C.C1=c2ccccc2=CCC1 |
| InChI | InChI=1S/C10H10.2CH4/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-2,5-8H,3-4H2;2*1H4 |
| InChIKey | LZCHKNFFURCJPI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dihydronaphthalene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydronaphthalene;methane?
The IUPAC name of 2,3-dihydronaphthalene;methane (CID 142417654) is 2,3-dihydronaphthalene;methane.
What is the SMILES notation for 2,3-dihydronaphthalene;methane?
The canonical SMILES for 2,3-dihydronaphthalene;methane is C.C.C1=c2ccccc2=CCC1.
What is the InChIKey of 2,3-dihydronaphthalene;methane?
The InChIKey is LZCHKNFFURCJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.2CH4/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-2,5-8H,3-4H2;2*1H4.
What are the key properties of 2,3-dihydronaphthalene;methane?
2,3-dihydronaphthalene;methane has a molecular weight of 162.28 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydronaphthalene;methane is sourced from PubChem (CID 142417654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).