C25H32FN3O3 — CID 142418983
fluoro (2S)-2-[(3R)-3-[4-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-phenylacetate (PubChem CID 142418983) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is fluoro (2S)-2-[(3R)-3-[4-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-phenylacetate.
| Compound Name | fluoro (2S)-2-[(3R)-3-[4-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 142418983 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | fluoro (2S)-2-[(3R)-3-[4-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-phenylacetate |
| SMILES | CC1CCc2ccc(CCCCO[C@@H]3CCN([C@H](C(=O)OF)c4ccccc4)C3)nc2N1 |
| InChI | InChI=1S/C25H32FN3O3/c1-18-10-11-20-12-13-21(28-24(20)27-18)9-5-6-16-31-22-14-15-29(17-22)23(25(30)32-26)19-7-3-2-4-8-19/h2-4,7-8,12-13,18,22-23H,5-6,9-11,14-17H2,1H3,(H,27,28)/t18?,22-,23+/m1/s1 |
| InChIKey | DMPBNCCAQRQFBM-ZPUYXXQXSA-N |
| XLogP | 4.41 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|