C8H12Cl2N2 — CID 142419123
1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride (PubChem CID 142419123) has the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. Its IUPAC name is 1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride.
| Compound Name | 1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride |
|---|---|
| PubChem CID | 142419123 |
| Molecular Formula | C8H12Cl2N2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cnc2c(c1)CCCN2 |
| InChI | InChI=1S/C8H10N2.2ClH/c1-3-7-4-2-6-10-8(7)9-5-1;;/h1,3,5H,2,4,6H2,(H,9,10);2*1H |
| InChIKey | SJWKTAPOPSSMDK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |