About US10603320, Example 7
US10603320, Example 7 (PubChem CID 142419262) has the molecular formula C29H32F3N5O4S2
and a molecular weight of 635.73 g/mol.
Molecular Properties
| Compound Name | US10603320, Example 7 |
| PubChem CID | 142419262 |
| Molecular Formula | C29H32F3N5O4S2 |
| Molecular Weight | 635.73 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | — |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2cc3c(s2)C2(CCN([C@H](C)c4cnc(C(F)(F)F)nc4)CC2)OC2(CC2)C3)nc1 |
| InChI | InChI=1S/C29H32F3N5O4S2/c1-3-43(39,40)22-5-4-21(33-17-22)16-34-25(38)23-12-19-13-27(6-7-27)41-28(24(19)42-23)8-10-37(11-9-28)18(2)20-14-35-26(36-15-20)29(30,31)32/h4-5,12,14-15,17-18H,3,6-11,13,16H2,1-2H3,(H,34,38)/t18-/m1/s1 |
| InChIKey | GPFKJSWERRLMSX-GOSISDBHSA-N |
| XLogP | 4.83 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 635.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze US10603320, Example 7 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10603320, Example 7?
The IUPAC name of US10603320, Example 7 (CID 142419262) is not available.
What is the SMILES notation for US10603320, Example 7?
The canonical SMILES for US10603320, Example 7 is CCS(=O)(=O)c1ccc(CNC(=O)c2cc3c(s2)C2(CCN([C@H](C)c4cnc(C(F)(F)F)nc4)CC2)OC2(CC2)C3)nc1.
What is the InChIKey of US10603320, Example 7?
The InChIKey is GPFKJSWERRLMSX-GOSISDBHSA-N. The full InChI is InChI=1S/C29H32F3N5O4S2/c1-3-43(39,40)22-5-4-21(33-17-22)16-34-25(38)23-12-19-13-27(6-7-27)41-28(24(19)42-23)8-10-37(11-9-28)18(2)20-14-35-26(36-15-20)29(30,31)32/h4-5,12,14-15,17-18H,3,6-11,13,16H2,1-2H3,(H,34,38)/t18-/m1/s1.
What are the key properties of US10603320, Example 7?
US10603320, Example 7 has a molecular weight of 635.73 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for US10603320, Example 7 is sourced from PubChem (CID 142419262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).