C25H27F3N6O3 — CID 142419470
8-(2,4-dimethoxyphenyl)-2-[4-(propylaminomethyl)-3-(trifluoromethyl)anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one (PubChem CID 142419470) has the molecular formula C25H27F3N6O3 and a molecular weight of 516.52 g/mol. Its IUPAC name is 8-(2,4-dimethoxyphenyl)-2-[4-(propylaminomethyl)-3-(trifluoromethyl)anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 8-(2,4-dimethoxyphenyl)-2-[4-(propylaminomethyl)-3-(trifluoromethyl)anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142419470 |
| Molecular Formula | C25H27F3N6O3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 8-(2,4-dimethoxyphenyl)-2-[4-(propylaminomethyl)-3-(trifluoromethyl)anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
| SMILES | CCCNCc1ccc(Nc2ncc3c(n2)N(c2ccc(OC)cc2OC)C(=O)NC3)cc1C(F)(F)F |
| InChI | InChI=1S/C25H27F3N6O3/c1-4-9-29-12-15-5-6-17(10-19(15)25(26,27)28)32-23-30-13-16-14-31-24(35)34(22(16)33-23)20-8-7-18(36-2)11-21(20)37-3/h5-8,10-11,13,29H,4,9,12,14H2,1-3H3,(H,31,35)(H,30,32,33) |
| InChIKey | CYCMHZPHPXHFFA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|