C21H27ClN4O — CID 142419501
N-[2-chloro-5-[(N,2,6-trimethylanilino)methyl]pyrimidin-4-yl]-N-cyclohexylformamide (PubChem CID 142419501) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is N-[2-chloro-5-[(N,2,6-trimethylanilino)methyl]pyrimidin-4-yl]-N-cyclohexylformamide.
| Compound Name | N-[2-chloro-5-[(N,2,6-trimethylanilino)methyl]pyrimidin-4-yl]-N-cyclohexylformamide |
|---|---|
| PubChem CID | 142419501 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[2-chloro-5-[(N,2,6-trimethylanilino)methyl]pyrimidin-4-yl]-N-cyclohexylformamide |
| SMILES | Cc1cccc(C)c1N(C)Cc1cnc(Cl)nc1N(C=O)C1CCCCC1 |
| InChI | InChI=1S/C21H27ClN4O/c1-15-8-7-9-16(2)19(15)25(3)13-17-12-23-21(22)24-20(17)26(14-27)18-10-5-4-6-11-18/h7-9,12,14,18H,4-6,10-11,13H2,1-3H3 |
| InChIKey | HHTQGGWAPOGQBT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|