C19H19ClFN5OS2 — CID 142420163
(3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-3-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 142420163) has the molecular formula C19H19ClFN5OS2 and a molecular weight of 451.98 g/mol. Its IUPAC name is (3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-3-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-3-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 142420163 |
| Molecular Formula | C19H19ClFN5OS2 |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | (3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-3-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1SN[C@H](c2ccc(-c3ccn(C)n3)s2)C[C@@H]1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClFN5OS2/c1-25-8-7-14(23-25)17-5-6-18(28-17)15-10-16(26(2)29-24-15)19(27)22-11-3-4-13(21)12(20)9-11/h3-9,15-16,24H,10H2,1-2H3,(H,22,27)/t15-,16+/m0/s1 |
| InChIKey | KRNFTXMFDKDTDM-JKSUJKDBSA-N |
| XLogP | 4.48 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|