About 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole
8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole (PubChem CID 142420189) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole.
Molecular Properties
| Compound Name | 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole |
| PubChem CID | 142420189 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole |
| SMILES | CC(C)c1nc2c(o1)C(C)(C)C=CC=C2 |
| InChI | InChI=1S/C13H17NO/c1-9(2)12-14-10-7-5-6-8-13(3,4)11(10)15-12/h5-9H,1-4H3 |
| InChIKey | SAKZJONWPGVQGK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole?
The IUPAC name of 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole (CID 142420189) is 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole.
What is the SMILES notation for 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole?
The canonical SMILES for 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole is CC(C)c1nc2c(o1)C(C)(C)C=CC=C2.
What is the InChIKey of 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole?
The InChIKey is SAKZJONWPGVQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9(2)12-14-10-7-5-6-8-13(3,4)11(10)15-12/h5-9H,1-4H3.
What are the key properties of 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole?
8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole has a molecular weight of 203.28 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-2-propan-2-ylcyclohepta[d][1,3]oxazole is sourced from PubChem (CID 142420189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).