C14H17N2O5P — CID 142420739
2-[3-acetyl-6-[ethoxy(methyl)phosphoryl]indazol-1-yl]acetic acid (PubChem CID 142420739) has the molecular formula C14H17N2O5P and a molecular weight of 324.27 g/mol. Its IUPAC name is 2-[3-acetyl-6-[ethoxy(methyl)phosphoryl]indazol-1-yl]acetic acid.
| Compound Name | 2-[3-acetyl-6-[ethoxy(methyl)phosphoryl]indazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 142420739 |
| Molecular Formula | C14H17N2O5P |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[3-acetyl-6-[ethoxy(methyl)phosphoryl]indazol-1-yl]acetic acid |
| SMILES | CCOP(C)(=O)c1ccc2c(C(C)=O)nn(CC(=O)O)c2c1 |
| InChI | InChI=1S/C14H17N2O5P/c1-4-21-22(3,20)10-5-6-11-12(7-10)16(8-13(18)19)15-14(11)9(2)17/h5-7H,4,8H2,1-3H3,(H,18,19) |
| InChIKey | XQXSWPBVWWIWOH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|